C11H15NO5 — CID 90467056
ethyl (2R,3R)-2-amino-3-deuterio-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoate (PubChem CID 90467056) has the molecular formula C11H15NO5 and a molecular weight of 242.25 g/mol. Its IUPAC name is ethyl (2R,3R)-2-amino-3-deuterio-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoate.
| Compound Name | ethyl (2R,3R)-2-amino-3-deuterio-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 90467056 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | ethyl (2R,3R)-2-amino-3-deuterio-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoate |
| SMILES | [2H][C@@](O)(c1ccc(O)c(O)c1)[C@@H](N)C(=O)OCC |
| InChI | InChI=1S/C11H15NO5/c1-2-17-11(16)9(12)10(15)6-3-4-7(13)8(14)5-6/h3-5,9-10,13-15H,2,12H2,1H3/t9-,10-/m1/s1/i10D |
| InChIKey | AWRQZFQCRWFSRX-JYNMYYNASA-N |
| XLogP | 0.02 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|