C14H21NO4 — CID 174998023
ethyl 2-amino-2,3-dideuterio-3-(3,4-dihydroxyphenyl)hexanoate (PubChem CID 174998023) has the molecular formula C14H21NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is ethyl 2-amino-2,3-dideuterio-3-(3,4-dihydroxyphenyl)hexanoate.
| Compound Name | ethyl 2-amino-2,3-dideuterio-3-(3,4-dihydroxyphenyl)hexanoate |
|---|---|
| PubChem CID | 174998023 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | ethyl 2-amino-2,3-dideuterio-3-(3,4-dihydroxyphenyl)hexanoate |
| SMILES | [2H]C(N)(C(=O)OCC)C([2H])(CCC)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H21NO4/c1-3-5-10(13(15)14(18)19-4-2)9-6-7-11(16)12(17)8-9/h6-8,10,13,16-17H,3-5,15H2,1-2H3/i10D,13D |
| InChIKey | NBGOWICNTSCDJE-JVWQUBBQSA-N |
| XLogP | 1.87 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|