C10H12O4 — CID 87758018
methyl 2,3-dideuterio-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoate (PubChem CID 87758018) has the molecular formula C10H12O4 and a molecular weight of 201.23 g/mol. Its IUPAC name is methyl 2,3-dideuterio-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoate.
| Compound Name | methyl 2,3-dideuterio-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 87758018 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | methyl 2,3-dideuterio-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoate |
| SMILES | [2H]c1c([2H])c(C([2H])C([2H])C(=O)OC)c([2H])c(O)c1O |
| InChI | InChI=1S/C10H12O4/c1-14-10(13)5-3-7-2-4-8(11)9(12)6-7/h2,4,6,11-12H,3,5H2,1H3/i2D,3D,4D,5D,6D |
| InChIKey | NTULQOXXTCSEHM-VIQYUKPQSA-N |
| XLogP | 1.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|