C11H11F3O5S — CID 59096837
methyl 2-deuterio-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate (PubChem CID 59096837) has the molecular formula C11H11F3O5S and a molecular weight of 313.27 g/mol. Its IUPAC name is methyl 2-deuterio-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate.
| Compound Name | methyl 2-deuterio-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 59096837 |
| Molecular Formula | C11H11F3O5S |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | methyl 2-deuterio-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
| SMILES | [2H]C(Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1)C(=O)OC |
| InChI | InChI=1S/C11H11F3O5S/c1-18-10(15)7-4-8-2-5-9(6-3-8)19-20(16,17)11(12,13)14/h2-3,5-6H,4,7H2,1H3/i7D |
| InChIKey | PKFMCLUFGXNQQA-WHRKIXHSSA-N |
| XLogP | 2.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|