C14H20O2 — CID 59015029
methyl 2,3,3,3-tetradeuterio-2-[2,3,5,6-tetradeuterio-4-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]phenyl]propanoate (PubChem CID 59015029) has the molecular formula C14H20O2 and a molecular weight of 237.42 g/mol. Its IUPAC name is methyl 2,3,3,3-tetradeuterio-2-[2,3,5,6-tetradeuterio-4-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]phenyl]propanoate.
| Compound Name | methyl 2,3,3,3-tetradeuterio-2-[2,3,5,6-tetradeuterio-4-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]phenyl]propanoate |
|---|---|
| PubChem CID | 59015029 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 237.42 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | methyl 2,3,3,3-tetradeuterio-2-[2,3,5,6-tetradeuterio-4-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]phenyl]propanoate |
| SMILES | [2H]c1c([2H])c(C([2H])(C(=O)OC)C([2H])([2H])[2H])c([2H])c([2H])c1C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C14H20O2/c1-10(2)9-12-5-7-13(8-6-12)11(3)14(15)16-4/h5-8,10-11H,9H2,1-4H3/i1D3,2D3,3D3,5D,6D,7D,8D,9D2,10D,11D |
| InChIKey | YNZYUHPFNYBBFF-RCQSLCOPSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |