C28H22N6O2 — CID 90467462
5-[4-[5-(2-phenylethyl)tetrazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione (PubChem CID 90467462) has the molecular formula C28H22N6O2 and a molecular weight of 474.52 g/mol. Its IUPAC name is 5-[4-[5-(2-phenylethyl)tetrazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione.
| Compound Name | 5-[4-[5-(2-phenylethyl)tetrazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 90467462 |
| Molecular Formula | C28H22N6O2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 5-[4-[5-(2-phenylethyl)tetrazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| SMILES | O=C1CC(=O)N(c2ccc(-n3nnnc3CCc3ccccc3)cc2)c2ccc3ccccc3c2N1 |
| InChI | InChI=1S/C28H22N6O2/c35-26-18-27(36)33(24-16-11-20-8-4-5-9-23(20)28(24)29-26)21-12-14-22(15-13-21)34-25(30-31-32-34)17-10-19-6-2-1-3-7-19/h1-9,11-16H,10,17-18H2,(H,29,35) |
| InChIKey | LJAZWAVMCOOFLM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|