C26H24FN5O4 — CID 90469418
N-[3-[[2-[4-(2-cyclopropyloxyethoxy)-3-fluoroanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide (PubChem CID 90469418) has the molecular formula C26H24FN5O4 and a molecular weight of 489.51 g/mol. Its IUPAC name is N-[3-[[2-[4-(2-cyclopropyloxyethoxy)-3-fluoroanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-(2-cyclopropyloxyethoxy)-3-fluoroanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90469418 |
| Molecular Formula | C26H24FN5O4 |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-[3-[[2-[4-(2-cyclopropyloxyethoxy)-3-fluoroanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(OCCOC4CC4)c(F)c3)nc3[nH]ccc23)c1 |
| InChI | InChI=1S/C26H24FN5O4/c1-2-23(33)29-16-4-3-5-19(14-16)36-25-20-10-11-28-24(20)31-26(32-25)30-17-6-9-22(21(27)15-17)35-13-12-34-18-7-8-18/h2-6,9-11,14-15,18H,1,7-8,12-13H2,(H,29,33)(H2,28,30,31,32) |
| InChIKey | DOZWSBZPGRNBBN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 110.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|