C48H96O22 — CID 90469788
2,3-dihydroxypropyl 2,2,3,3,4,4,5,5,6-nonakis(2,3-dihydroxypropyl)-16-methylheptadecanoate (PubChem CID 90469788) has the molecular formula C48H96O22 and a molecular weight of 1025.27 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2,2,3,3,4,4,5,5,6-nonakis(2,3-dihydroxypropyl)-16-methylheptadecanoate.
| Compound Name | 2,3-dihydroxypropyl 2,2,3,3,4,4,5,5,6-nonakis(2,3-dihydroxypropyl)-16-methylheptadecanoate |
|---|---|
| PubChem CID | 90469788 |
| Molecular Formula | C48H96O22 |
| Molecular Weight | 1025.27 g/mol |
| Exact Mass | 1024.64 |
| IUPAC Name | 2,3-dihydroxypropyl 2,2,3,3,4,4,5,5,6-nonakis(2,3-dihydroxypropyl)-16-methylheptadecanoate |
| SMILES | CC(C)CCCCCCCCCC(CC(O)CO)C(CC(O)CO)(CC(O)CO)C(CC(O)CO)(CC(O)CO)C(CC(O)CO)(CC(O)CO)C(CC(O)CO)(CC(O)CO)C(=O)OCC(O)CO |
| InChI | InChI=1S/C48H96O22/c1-32(2)10-8-6-4-3-5-7-9-11-33(12-34(59)21-49)45(13-35(60)22-50,14-36(61)23-51)47(17-39(64)26-54,18-40(65)27-55)48(19-41(66)28-56,20-42(67)29-57)46(15-37(62)24-52,16-38(63)25-53)44(69)70-31-43(68)30-58/h32-43,49-68H,3-31H2,1-2H3 |
| InChIKey | OPKQRMPUGFJLOM-UHFFFAOYSA-N |
| XLogP | -3.70 |
| TPSA | 430.90 Ų |
| H-Bond Donors | 20 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.27 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 20 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|