About 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol
5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol (PubChem CID 90474539) has the molecular formula C22H20O2
and a molecular weight of 316.40 g/mol. Its IUPAC name is 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol.
Molecular Properties
| Compound Name | 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol |
| PubChem CID | 90474539 |
| Molecular Formula | C22H20O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol |
| SMILES | Cc1ccc2c(O)cccc2c1.Cc1cccc2cc(O)ccc12 |
| InChI | InChI=1S/2C11H10O/c1-8-5-6-10-9(7-8)3-2-4-11(10)12;1-8-3-2-4-9-7-10(12)5-6-11(8)9/h2*2-7,12H,1H3 |
| InChIKey | HOYPBHWNFAOMCI-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol?
The IUPAC name of 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol (CID 90474539) is 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol.
What is the SMILES notation for 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol?
The canonical SMILES for 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol is Cc1ccc2c(O)cccc2c1.Cc1cccc2cc(O)ccc12.
What is the InChIKey of 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol?
The InChIKey is HOYPBHWNFAOMCI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H10O/c1-8-5-6-10-9(7-8)3-2-4-11(10)12;1-8-3-2-4-9-7-10(12)5-6-11(8)9/h2*2-7,12H,1H3.
What are the key properties of 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol?
5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol has a molecular weight of 316.40 g/mol, XLogP of 5.71, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylnaphthalen-2-ol;6-methylnaphthalen-1-ol is sourced from PubChem (CID 90474539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).