C18H27N4NaO5S — CID 90475495
sodium N-(2-ethylhexyl)-2-[(2-hydroxy-5-sulfamoylphenyl)diazenyl]-3-oxobutanamide (PubChem CID 90475495) has the molecular formula C18H27N4NaO5S and a molecular weight of 434.49 g/mol. Its IUPAC name is sodium N-(2-ethylhexyl)-2-[(2-hydroxy-5-sulfamoylphenyl)diazenyl]-3-oxobutanamide.
| Compound Name | sodium N-(2-ethylhexyl)-2-[(2-hydroxy-5-sulfamoylphenyl)diazenyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 90475495 |
| Molecular Formula | C18H27N4NaO5S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | sodium N-(2-ethylhexyl)-2-[(2-hydroxy-5-sulfamoylphenyl)diazenyl]-3-oxobutanamide |
| SMILES | CCCCC(CC)CNC(=O)[C-](/N=N/c1cc(S(N)(=O)=O)ccc1O)C(C)=O.[Na+] |
| InChI | InChI=1S/C18H27N4O5S.Na/c1-4-6-7-13(5-2)11-20-18(25)17(12(3)23)22-21-15-10-14(28(19,26)27)8-9-16(15)24;/h8-10,13,24H,4-7,11H2,1-3H3,(H,20,25)(H2,19,26,27);/q-1;+1/b22-21+; |
| InChIKey | XKBIMMNEZBLEKD-QUABFQRHSA-N |
| XLogP | -0.42 |
| TPSA | 151.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|