C8H10O2 — CID 90475750
1,2,4,5-tetradeuterio-3,6-bis(trideuteriomethoxy)benzene (PubChem CID 90475750) has the molecular formula C8H10O2 and a molecular weight of 148.23 g/mol. Its IUPAC name is 1,2,4,5-tetradeuterio-3,6-bis(trideuteriomethoxy)benzene.
| Compound Name | 1,2,4,5-tetradeuterio-3,6-bis(trideuteriomethoxy)benzene |
|---|---|
| PubChem CID | 90475750 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 1,2,4,5-tetradeuterio-3,6-bis(trideuteriomethoxy)benzene |
| SMILES | [2H]c1c([2H])c(OC([2H])([2H])[2H])c([2H])c([2H])c1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C8H10O2/c1-9-7-3-5-8(10-2)6-4-7/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D |
| InChIKey | OHBQPCCCRFSCAX-ZGYYUIRESA-N |
| XLogP | 1.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |