C17H22FNO3 — CID 90477201
tert-butyl 3-(3-fluoro-5-methylphenyl)-4-oxopiperidine-1-carboxylate (PubChem CID 90477201) has the molecular formula C17H22FNO3 and a molecular weight of 307.37 g/mol. Its IUPAC name is tert-butyl 3-(3-fluoro-5-methylphenyl)-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-fluoro-5-methylphenyl)-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 90477201 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | tert-butyl 3-(3-fluoro-5-methylphenyl)-4-oxopiperidine-1-carboxylate |
| SMILES | Cc1cc(F)cc(C2CN(C(=O)OC(C)(C)C)CCC2=O)c1 |
| InChI | InChI=1S/C17H22FNO3/c1-11-7-12(9-13(18)8-11)14-10-19(6-5-15(14)20)16(21)22-17(2,3)4/h7-9,14H,5-6,10H2,1-4H3 |
| InChIKey | RGXUTDYFFFAOAY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |