C18H26N2O5 — CID 164734743
tert-butyl 3-[5-(dimethoxymethyl)-3-pyridinyl]-4-oxopiperidine-1-carboxylate (PubChem CID 164734743) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is tert-butyl 3-[5-(dimethoxymethyl)-3-pyridinyl]-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-(dimethoxymethyl)-3-pyridinyl]-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 164734743 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | tert-butyl 3-[5-(dimethoxymethyl)-3-pyridinyl]-4-oxopiperidine-1-carboxylate |
| SMILES | COC(OC)c1cncc(C2CN(C(=O)OC(C)(C)C)CCC2=O)c1 |
| InChI | InChI=1S/C18H26N2O5/c1-18(2,3)25-17(22)20-7-6-15(21)14(11-20)12-8-13(10-19-9-12)16(23-4)24-5/h8-10,14,16H,6-7,11H2,1-5H3 |
| InChIKey | MUANYSKNYJHFCT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|