C16H16O — CID 90482478
1-(6-pentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3(8),4,6-trienyl)ethanone (PubChem CID 90482478) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(6-pentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3(8),4,6-trienyl)ethanone.
| Compound Name | 1-(6-pentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3(8),4,6-trienyl)ethanone |
|---|---|
| PubChem CID | 90482478 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(6-pentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3(8),4,6-trienyl)ethanone |
| SMILES | CC(=O)c1ccc2c(c1)C1C3CCC3C3C2C13 |
| InChI | InChI=1S/C16H16O/c1-7(17)8-2-3-11-12(6-8)13-9-4-5-10(9)14-15(11)16(13)14/h2-3,6,9-10,13-16H,4-5H2,1H3 |
| InChIKey | RIZPIOIQESKPGJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'} |
|---|