C17H25Cl2F2N3O4 — CID 90485169
N-[4-[chloro(difluoro)methoxy]phenyl]-2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]acetamide;hydrochloride (PubChem CID 90485169) has the molecular formula C17H25Cl2F2N3O4 and a molecular weight of 444.31 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]acetamide;hydrochloride.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 90485169 |
| Molecular Formula | C17H25Cl2F2N3O4 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CCN(CCOCCO)CC1)Nc1ccc(OC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C17H24ClF2N3O4.ClH/c18-17(19,20)27-15-3-1-14(2-4-15)21-16(25)13-23-7-5-22(6-8-23)9-11-26-12-10-24;/h1-4,24H,5-13H2,(H,21,25);1H |
| InChIKey | RFCXCOVGEZQARR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|