C23H17NO6 — CID 90489438
N-[4-[2-[[3-(furan-2-carbonyl)-1-benzofuran-5-yl]oxy]acetyl]phenyl]acetamide (PubChem CID 90489438) has the molecular formula C23H17NO6 and a molecular weight of 403.39 g/mol. Its IUPAC name is N-[4-[2-[[3-(furan-2-carbonyl)-1-benzofuran-5-yl]oxy]acetyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[[3-(furan-2-carbonyl)-1-benzofuran-5-yl]oxy]acetyl]phenyl]acetamide |
|---|---|
| PubChem CID | 90489438 |
| Molecular Formula | C23H17NO6 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-[4-[2-[[3-(furan-2-carbonyl)-1-benzofuran-5-yl]oxy]acetyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=O)COc2ccc3occ(C(=O)c4ccco4)c3c2)cc1 |
| InChI | InChI=1S/C23H17NO6/c1-14(25)24-16-6-4-15(5-7-16)20(26)13-29-17-8-9-21-18(11-17)19(12-30-21)23(27)22-3-2-10-28-22/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | KXWMZIRVCMPQJH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |