C20H24N6O3 — CID 90492065
5-(furan-2-yl)-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]-1H-pyrazole-3-carboxamide (PubChem CID 90492065) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 90492065 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 5-(furan-2-yl)-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1nc(OCCNC(=O)c2cc(-c3ccco3)[nH]n2)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C20H24N6O3/c1-14-22-18(26-8-3-2-4-9-26)13-19(23-14)29-11-7-21-20(27)16-12-15(24-25-16)17-6-5-10-28-17/h5-6,10,12-13H,2-4,7-9,11H2,1H3,(H,21,27)(H,24,25) |
| InChIKey | OWWRILSMNVNHBB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|