C13H19N7OS — CID 90494845
2-(1-methyltetrazol-5-yl)sulfanyl-1-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]ethanone (PubChem CID 90494845) has the molecular formula C13H19N7OS and a molecular weight of 321.41 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-1-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90494845 |
| Molecular Formula | C13H19N7OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]ethanone |
| SMILES | Cn1nnnc1SCC(=O)N1CCC(Cn2cccn2)CC1 |
| InChI | InChI=1S/C13H19N7OS/c1-18-13(15-16-17-18)22-10-12(21)19-7-3-11(4-8-19)9-20-6-2-5-14-20/h2,5-6,11H,3-4,7-10H2,1H3 |
| InChIKey | FLTNYHJDDQZCGD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |