C19H13N3O3 — CID 9052309
(4Z)-2-(2-methoxyphenyl)-4-(quinoxalin-2-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 9052309) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is (4Z)-2-(2-methoxyphenyl)-4-(quinoxalin-2-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2-methoxyphenyl)-4-(quinoxalin-2-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9052309 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (4Z)-2-(2-methoxyphenyl)-4-(quinoxalin-2-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | COc1ccccc1C1=N/C(=C\c2cnc3ccccc3n2)C(=O)O1 |
| InChI | InChI=1S/C19H13N3O3/c1-24-17-9-5-2-6-13(17)18-22-16(19(23)25-18)10-12-11-20-14-7-3-4-8-15(14)21-12/h2-11H,1H3/b16-10- |
| InChIKey | SGICVNXVVGPAFL-YBEGLDIGSA-N |
| XLogP | 2.98 |
| TPSA | 73.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|