C20H24N6O4S — CID 90538679
4-(diethylsulfamoyl)-N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]benzamide (PubChem CID 90538679) has the molecular formula C20H24N6O4S and a molecular weight of 444.52 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 90538679 |
| Molecular Formula | C20H24N6O4S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCn2nc(-n3cccn3)ccc2=O)cc1 |
| InChI | InChI=1S/C20H24N6O4S/c1-3-24(4-2)31(29,30)17-8-6-16(7-9-17)20(28)21-13-15-26-19(27)11-10-18(23-26)25-14-5-12-22-25/h5-12,14H,3-4,13,15H2,1-2H3,(H,21,28) |
| InChIKey | ULNPEWDEDXXDNV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |