C18H20N6O4S — CID 90538681
4-(dimethylsulfamoyl)-N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]benzamide (PubChem CID 90538681) has the molecular formula C18H20N6O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 90538681 |
| Molecular Formula | C18H20N6O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NCCn2nc(-n3cccn3)ccc2=O)cc1 |
| InChI | InChI=1S/C18H20N6O4S/c1-22(2)29(27,28)15-6-4-14(5-7-15)18(26)19-11-13-24-17(25)9-8-16(21-24)23-12-3-10-20-23/h3-10,12H,11,13H2,1-2H3,(H,19,26) |
| InChIKey | YWTLZXIIKXFRIO-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |