C22H21N7O2 — CID 90539541
1-[4-(6-imidazol-1-ylpyridazin-3-yl)piperazin-1-yl]-2-(2-methyl-1H-indol-3-yl)ethane-1,2-dione (PubChem CID 90539541) has the molecular formula C22H21N7O2 and a molecular weight of 415.46 g/mol. Its IUPAC name is 1-[4-(6-imidazol-1-ylpyridazin-3-yl)piperazin-1-yl]-2-(2-methyl-1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-[4-(6-imidazol-1-ylpyridazin-3-yl)piperazin-1-yl]-2-(2-methyl-1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 90539541 |
| Molecular Formula | C22H21N7O2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 1-[4-(6-imidazol-1-ylpyridazin-3-yl)piperazin-1-yl]-2-(2-methyl-1H-indol-3-yl)ethane-1,2-dione |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(=O)N1CCN(c2ccc(-n3ccnc3)nn2)CC1 |
| InChI | InChI=1S/C22H21N7O2/c1-15-20(16-4-2-3-5-17(16)24-15)21(30)22(31)28-12-10-27(11-13-28)18-6-7-19(26-25-18)29-9-8-23-14-29/h2-9,14,24H,10-13H2,1H3 |
| InChIKey | ZUMGFLLJTGHXDC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|