C11H19F3N2O2 — CID 90554858
1-(oxan-4-yl)-3-propan-2-yl-1-(2,2,2-trifluoroethyl)urea (PubChem CID 90554858) has the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-(oxan-4-yl)-3-propan-2-yl-1-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(oxan-4-yl)-3-propan-2-yl-1-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 90554858 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(oxan-4-yl)-3-propan-2-yl-1-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(C)NC(=O)N(CC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C11H19F3N2O2/c1-8(2)15-10(17)16(7-11(12,13)14)9-3-5-18-6-4-9/h8-9H,3-7H2,1-2H3,(H,15,17) |
| InChIKey | IKWHLTXKPQVING-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |