C10H17F3N2O2 — CID 90554859
3-ethyl-1-(oxan-4-yl)-1-(2,2,2-trifluoroethyl)urea (PubChem CID 90554859) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 3-ethyl-1-(oxan-4-yl)-1-(2,2,2-trifluoroethyl)urea.
| Compound Name | 3-ethyl-1-(oxan-4-yl)-1-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 90554859 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-ethyl-1-(oxan-4-yl)-1-(2,2,2-trifluoroethyl)urea |
| SMILES | CCNC(=O)N(CC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C10H17F3N2O2/c1-2-14-9(16)15(7-10(11,12)13)8-3-5-17-6-4-8/h8H,2-7H2,1H3,(H,14,16) |
| InChIKey | CPCYEAXDOXTQFL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |