C21H23N3O4S — CID 90560120
2-[1-(4-ethoxyphenyl)sulfonylpiperidin-4-yl]oxyquinoxaline (PubChem CID 90560120) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-[1-(4-ethoxyphenyl)sulfonylpiperidin-4-yl]oxyquinoxaline.
| Compound Name | 2-[1-(4-ethoxyphenyl)sulfonylpiperidin-4-yl]oxyquinoxaline |
|---|---|
| PubChem CID | 90560120 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-[1-(4-ethoxyphenyl)sulfonylpiperidin-4-yl]oxyquinoxaline |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(Oc3cnc4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C21H23N3O4S/c1-2-27-16-7-9-18(10-8-16)29(25,26)24-13-11-17(12-14-24)28-21-15-22-19-5-3-4-6-20(19)23-21/h3-10,15,17H,2,11-14H2,1H3 |
| InChIKey | OOOZMDCQHYMAGJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |