C20H20ClN3O3 — CID 90566740
(4-chloro-3-nitrophenyl)-(4-cyclopropyl-2-phenylpiperazin-1-yl)methanone (PubChem CID 90566740) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-(4-cyclopropyl-2-phenylpiperazin-1-yl)methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-(4-cyclopropyl-2-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 90566740 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-(4-cyclopropyl-2-phenylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N1CCN(C2CC2)CC1c1ccccc1 |
| InChI | InChI=1S/C20H20ClN3O3/c21-17-9-6-15(12-18(17)24(26)27)20(25)23-11-10-22(16-7-8-16)13-19(23)14-4-2-1-3-5-14/h1-6,9,12,16,19H,7-8,10-11,13H2 |
| InChIKey | FXLCFWXMCQAKED-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|