C22H16ClN3O3 — CID 5091400
(4-chloro-3-nitrophenyl)-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)methanone (PubChem CID 5091400) has the molecular formula C22H16ClN3O3 and a molecular weight of 405.84 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)methanone |
|---|---|
| PubChem CID | 5091400 |
| Molecular Formula | C22H16ClN3O3 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)methanone |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N1N=C(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C22H16ClN3O3/c23-18-12-11-17(13-21(18)26(28)29)22(27)25-20(16-9-5-2-6-10-16)14-19(24-25)15-7-3-1-4-8-15/h1-13,20H,14H2 |
| InChIKey | DDNNWOUFZMOSDO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|