C20H23N3O2S — CID 90570427
N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylcyclohexanesulfonamide (PubChem CID 90570427) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylcyclohexanesulfonamide.
| Compound Name | N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylcyclohexanesulfonamide |
|---|---|
| PubChem CID | 90570427 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylcyclohexanesulfonamide |
| SMILES | O=S(=O)(C1CCCCC1)N(Cc1cnc2ccccn12)c1ccccc1 |
| InChI | InChI=1S/C20H23N3O2S/c24-26(25,19-11-5-2-6-12-19)23(17-9-3-1-4-10-17)16-18-15-21-20-13-7-8-14-22(18)20/h1,3-4,7-10,13-15,19H,2,5-6,11-12,16H2 |
| InChIKey | ZQBRBMLLTRQKIA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |