C17H27N3O2S — CID 90572765
8-tert-butyl-6-oxo-N-pentyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide (PubChem CID 90572765) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is 8-tert-butyl-6-oxo-N-pentyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide.
| Compound Name | 8-tert-butyl-6-oxo-N-pentyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide |
|---|---|
| PubChem CID | 90572765 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 8-tert-butyl-6-oxo-N-pentyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide |
| SMILES | CCCCCNC(=O)C1CSc2nc(C(C)(C)C)cc(=O)n2C1 |
| InChI | InChI=1S/C17H27N3O2S/c1-5-6-7-8-18-15(22)12-10-20-14(21)9-13(17(2,3)4)19-16(20)23-11-12/h9,12H,5-8,10-11H2,1-4H3,(H,18,22) |
| InChIKey | CHPVWZFNNDLJAS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|