C20H24FN3O3S — CID 97105500
(3S)-8-tert-butyl-N-[2-(4-fluorophenoxy)ethyl]-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide (PubChem CID 97105500) has the molecular formula C20H24FN3O3S and a molecular weight of 405.50 g/mol. Its IUPAC name is (3S)-8-tert-butyl-N-[2-(4-fluorophenoxy)ethyl]-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide.
| Compound Name | (3S)-8-tert-butyl-N-[2-(4-fluorophenoxy)ethyl]-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide |
|---|---|
| PubChem CID | 97105500 |
| Molecular Formula | C20H24FN3O3S |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (3S)-8-tert-butyl-N-[2-(4-fluorophenoxy)ethyl]-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide |
| SMILES | CC(C)(C)c1cc(=O)n2c(n1)SC[C@H](C(=O)NCCOc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C20H24FN3O3S/c1-20(2,3)16-10-17(25)24-11-13(12-28-19(24)23-16)18(26)22-8-9-27-15-6-4-14(21)5-7-15/h4-7,10,13H,8-9,11-12H2,1-3H3,(H,22,26)/t13-/m1/s1 |
| InChIKey | IXEULRRBACOCJE-CYBMUJFWSA-N |
| XLogP | 2.60 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|