C25H24N2O4 — CID 90580001
2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-(4-quinolin-7-yloxybut-2-ynyl)acetamide (PubChem CID 90580001) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-(4-quinolin-7-yloxybut-2-ynyl)acetamide.
| Compound Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-(4-quinolin-7-yloxybut-2-ynyl)acetamide |
|---|---|
| PubChem CID | 90580001 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-(4-quinolin-7-yloxybut-2-ynyl)acetamide |
| SMILES | CC1(C)Cc2cccc(OCC(=O)NCC#CCOc3ccc4cccnc4c3)c2O1 |
| InChI | InChI=1S/C25H24N2O4/c1-25(2)16-19-7-5-9-22(24(19)31-25)30-17-23(28)27-12-3-4-14-29-20-11-10-18-8-6-13-26-21(18)15-20/h5-11,13,15H,12,14,16-17H2,1-2H3,(H,27,28) |
| InChIKey | UCWVWQINKPRGCA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|