C24H24N2O3 — CID 90582283
N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-2-phenoxybenzamide (PubChem CID 90582283) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-2-phenoxybenzamide.
| Compound Name | N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-2-phenoxybenzamide |
|---|---|
| PubChem CID | 90582283 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-2-phenoxybenzamide |
| SMILES | CN1CCc2cc(C(O)CNC(=O)c3ccccc3Oc3ccccc3)ccc21 |
| InChI | InChI=1S/C24H24N2O3/c1-26-14-13-17-15-18(11-12-21(17)26)22(27)16-25-24(28)20-9-5-6-10-23(20)29-19-7-3-2-4-8-19/h2-12,15,22,27H,13-14,16H2,1H3,(H,25,28) |
| InChIKey | LDHXXNOJGPQFBT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|