C15H15Cl2NO3 — CID 90582703
2,5-dichloro-N-(furan-3-ylmethyl)-N-(2-methoxyethyl)benzamide (PubChem CID 90582703) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.19 g/mol. Its IUPAC name is 2,5-dichloro-N-(furan-3-ylmethyl)-N-(2-methoxyethyl)benzamide.
| Compound Name | 2,5-dichloro-N-(furan-3-ylmethyl)-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 90582703 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2,5-dichloro-N-(furan-3-ylmethyl)-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(Cc1ccoc1)C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H15Cl2NO3/c1-20-7-5-18(9-11-4-6-21-10-11)15(19)13-8-12(16)2-3-14(13)17/h2-4,6,8,10H,5,7,9H2,1H3 |
| InChIKey | OMHVDPSQUWTLHD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |