C15H17FN2O3 — CID 90582835
3-(4-fluorophenyl)-1-(furan-3-ylmethyl)-1-(2-methoxyethyl)urea (PubChem CID 90582835) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(furan-3-ylmethyl)-1-(2-methoxyethyl)urea.
| Compound Name | 3-(4-fluorophenyl)-1-(furan-3-ylmethyl)-1-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 90582835 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(furan-3-ylmethyl)-1-(2-methoxyethyl)urea |
| SMILES | COCCN(Cc1ccoc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H17FN2O3/c1-20-9-7-18(10-12-6-8-21-11-12)15(19)17-14-4-2-13(16)3-5-14/h2-6,8,11H,7,9-10H2,1H3,(H,17,19) |
| InChIKey | CCAVFJJKADDKPZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |