C12H20N2O5S — CID 90582750
N-(furan-3-ylmethyl)-N-(2-methoxyethyl)-2-[methyl(methylsulfonyl)amino]acetamide (PubChem CID 90582750) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-N-(2-methoxyethyl)-2-[methyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-(furan-3-ylmethyl)-N-(2-methoxyethyl)-2-[methyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 90582750 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-(furan-3-ylmethyl)-N-(2-methoxyethyl)-2-[methyl(methylsulfonyl)amino]acetamide |
| SMILES | COCCN(Cc1ccoc1)C(=O)CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C12H20N2O5S/c1-13(20(3,16)17)9-12(15)14(5-7-18-2)8-11-4-6-19-10-11/h4,6,10H,5,7-9H2,1-3H3 |
| InChIKey | CXGQVVJRUYFCIB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |