C21H19FN2O3S — CID 90586698
[3-(benzenesulfonyl)pyrrolidin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-2-yl]methanone (PubChem CID 90586698) has the molecular formula C21H19FN2O3S and a molecular weight of 398.46 g/mol. Its IUPAC name is [3-(benzenesulfonyl)pyrrolidin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-2-yl]methanone.
| Compound Name | [3-(benzenesulfonyl)pyrrolidin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 90586698 |
| Molecular Formula | C21H19FN2O3S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [3-(benzenesulfonyl)pyrrolidin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-2-yl]methanone |
| SMILES | O=C(c1cc(-c2ccc(F)cc2)c[nH]1)N1CCC(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H19FN2O3S/c22-17-8-6-15(7-9-17)16-12-20(23-13-16)21(25)24-11-10-19(14-24)28(26,27)18-4-2-1-3-5-18/h1-9,12-13,19,23H,10-11,14H2 |
| InChIKey | FZNIXOJLBIYGPH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |