C23H22F2N2O — CID 121146282
[3-(4-fluorophenyl)azepan-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-2-yl]methanone (PubChem CID 121146282) has the molecular formula C23H22F2N2O and a molecular weight of 380.44 g/mol. Its IUPAC name is [3-(4-fluorophenyl)azepan-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-2-yl]methanone.
| Compound Name | [3-(4-fluorophenyl)azepan-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 121146282 |
| Molecular Formula | C23H22F2N2O |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [3-(4-fluorophenyl)azepan-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-2-yl]methanone |
| SMILES | O=C(c1cc(-c2ccc(F)cc2)c[nH]1)N1CCCCC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H22F2N2O/c24-20-8-4-16(5-9-20)18-3-1-2-12-27(15-18)23(28)22-13-19(14-26-22)17-6-10-21(25)11-7-17/h4-11,13-14,18,26H,1-3,12,15H2 |
| InChIKey | OKSHAHACHWPTSW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |