C17H15F2NO3S — CID 90584821
[3-(benzenesulfonyl)pyrrolidin-1-yl]-(2,4-difluorophenyl)methanone (PubChem CID 90584821) has the molecular formula C17H15F2NO3S and a molecular weight of 351.37 g/mol. Its IUPAC name is [3-(benzenesulfonyl)pyrrolidin-1-yl]-(2,4-difluorophenyl)methanone.
| Compound Name | [3-(benzenesulfonyl)pyrrolidin-1-yl]-(2,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 90584821 |
| Molecular Formula | C17H15F2NO3S |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | [3-(benzenesulfonyl)pyrrolidin-1-yl]-(2,4-difluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1F)N1CCC(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H15F2NO3S/c18-12-6-7-15(16(19)10-12)17(21)20-9-8-14(11-20)24(22,23)13-4-2-1-3-5-13/h1-7,10,14H,8-9,11H2 |
| InChIKey | UIPDYGFXUORCEM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |