C13H15F2NO3S — CID 90585099
(2,4-difluorophenyl)-(4-methylsulfonylpiperidin-1-yl)methanone (PubChem CID 90585099) has the molecular formula C13H15F2NO3S and a molecular weight of 303.33 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(4-methylsulfonylpiperidin-1-yl)methanone.
| Compound Name | (2,4-difluorophenyl)-(4-methylsulfonylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 90585099 |
| Molecular Formula | C13H15F2NO3S |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (2,4-difluorophenyl)-(4-methylsulfonylpiperidin-1-yl)methanone |
| SMILES | CS(=O)(=O)C1CCN(C(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C13H15F2NO3S/c1-20(18,19)10-4-6-16(7-5-10)13(17)11-3-2-9(14)8-12(11)15/h2-3,8,10H,4-7H2,1H3 |
| InChIKey | UULJKMPCBZPGHA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |