C19H19NO5S — CID 90586799
[4-[3-(benzenesulfonyl)pyrrolidine-1-carbonyl]phenyl] acetate (PubChem CID 90586799) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is [4-[3-(benzenesulfonyl)pyrrolidine-1-carbonyl]phenyl] acetate.
| Compound Name | [4-[3-(benzenesulfonyl)pyrrolidine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 90586799 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [4-[3-(benzenesulfonyl)pyrrolidine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)N2CCC(S(=O)(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H19NO5S/c1-14(21)25-16-9-7-15(8-10-16)19(22)20-12-11-18(13-20)26(23,24)17-5-3-2-4-6-17/h2-10,18H,11-13H2,1H3 |
| InChIKey | QJPXHSHXYWQCRV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|