C20H21N3O2S2 — CID 90595482
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(3-methoxypyrrolidin-1-yl)phenyl]acetamide (PubChem CID 90595482) has the molecular formula C20H21N3O2S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(3-methoxypyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(3-methoxypyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 90595482 |
| Molecular Formula | C20H21N3O2S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(3-methoxypyrrolidin-1-yl)phenyl]acetamide |
| SMILES | COC1CCN(c2ccc(NC(=O)CSc3nc4ccccc4s3)cc2)C1 |
| InChI | InChI=1S/C20H21N3O2S2/c1-25-16-10-11-23(12-16)15-8-6-14(7-9-15)21-19(24)13-26-20-22-17-4-2-3-5-18(17)27-20/h2-9,16H,10-13H2,1H3,(H,21,24) |
| InChIKey | VTIJLGVPLJIBSD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|