C22H28N2O2S — CID 90595713
N-[4-(4-methoxypiperidin-1-yl)phenyl]-1-thiophen-2-ylcyclopentane-1-carboxamide (PubChem CID 90595713) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is N-[4-(4-methoxypiperidin-1-yl)phenyl]-1-thiophen-2-ylcyclopentane-1-carboxamide.
| Compound Name | N-[4-(4-methoxypiperidin-1-yl)phenyl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 90595713 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N-[4-(4-methoxypiperidin-1-yl)phenyl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
| SMILES | COC1CCN(c2ccc(NC(=O)C3(c4cccs4)CCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H28N2O2S/c1-26-19-10-14-24(15-11-19)18-8-6-17(7-9-18)23-21(25)22(12-2-3-13-22)20-5-4-16-27-20/h4-9,16,19H,2-3,10-15H2,1H3,(H,23,25) |
| InChIKey | NATYXWZPSUURHJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|