C12H12F7N3O2 — CID 90597762
2,2,3,3,4,4,4-heptafluoro-N-[1-(oxan-4-yl)pyrazol-4-yl]butanamide (PubChem CID 90597762) has the molecular formula C12H12F7N3O2 and a molecular weight of 363.23 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[1-(oxan-4-yl)pyrazol-4-yl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[1-(oxan-4-yl)pyrazol-4-yl]butanamide |
|---|---|
| PubChem CID | 90597762 |
| Molecular Formula | C12H12F7N3O2 |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[1-(oxan-4-yl)pyrazol-4-yl]butanamide |
| SMILES | O=C(Nc1cnn(C2CCOCC2)c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F7N3O2/c13-10(14,11(15,16)12(17,18)19)9(23)21-7-5-20-22(6-7)8-1-3-24-4-2-8/h5-6,8H,1-4H2,(H,21,23) |
| InChIKey | RNOWDBCJMBLIML-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|