C18H26N2O4 — CID 90605218
N-[2-(cyclohexen-1-yl)ethyl]-N'-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxamide (PubChem CID 90605218) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxamide |
|---|---|
| PubChem CID | 90605218 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxamide |
| SMILES | CC(O)(CNC(=O)C(=O)NCCC1=CCCCC1)Cc1ccco1 |
| InChI | InChI=1S/C18H26N2O4/c1-18(23,12-15-8-5-11-24-15)13-20-17(22)16(21)19-10-9-14-6-3-2-4-7-14/h5-6,8,11,23H,2-4,7,9-10,12-13H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | ICVISDACCBAAJC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|