C21H30N2O4 — CID 95983011
N-[2-(cyclohexen-1-yl)ethyl]-N'-[(2R)-2-hydroxy-3-(4-methoxyphenyl)-2-methylpropyl]oxamide (PubChem CID 95983011) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-[(2R)-2-hydroxy-3-(4-methoxyphenyl)-2-methylpropyl]oxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[(2R)-2-hydroxy-3-(4-methoxyphenyl)-2-methylpropyl]oxamide |
|---|---|
| PubChem CID | 95983011 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[(2R)-2-hydroxy-3-(4-methoxyphenyl)-2-methylpropyl]oxamide |
| SMILES | COc1ccc(C[C@@](C)(O)CNC(=O)C(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C21H30N2O4/c1-21(26,14-17-8-10-18(27-2)11-9-17)15-23-20(25)19(24)22-13-12-16-6-4-3-5-7-16/h6,8-11,26H,3-5,7,12-15H2,1-2H3,(H,22,24)(H,23,25)/t21-/m1/s1 |
| InChIKey | MDBZHKUGKHHEOT-OAQYLSRUSA-N |
| XLogP | 2.11 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|