C26H26N2O5 — CID 90618593
2-[6-oxo-6-(3-oxospiro[2-benzofuran-1,3'-piperidine]-1'-yl)hexyl]isoindole-1,3-dione (PubChem CID 90618593) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-[6-oxo-6-(3-oxospiro[2-benzofuran-1,3'-piperidine]-1'-yl)hexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-oxo-6-(3-oxospiro[2-benzofuran-1,3'-piperidine]-1'-yl)hexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90618593 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[6-oxo-6-(3-oxospiro[2-benzofuran-1,3'-piperidine]-1'-yl)hexyl]isoindole-1,3-dione |
| SMILES | O=C1OC2(CCCN(C(=O)CCCCCN3C(=O)c4ccccc4C3=O)C2)c2ccccc21 |
| InChI | InChI=1S/C26H26N2O5/c29-22(13-2-1-7-16-28-23(30)18-9-3-4-10-19(18)24(28)31)27-15-8-14-26(17-27)21-12-6-5-11-20(21)25(32)33-26/h3-6,9-12H,1-2,7-8,13-17H2 |
| InChIKey | LPOOSFNUVUODJX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|