C19H16N4O5 — CID 90622579
N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]-4-nitrobenzamide (PubChem CID 90622579) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]-4-nitrobenzamide.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 90622579 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]-4-nitrobenzamide |
| SMILES | O=C(Nc1cnn(CC2COc3ccccc3O2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16N4O5/c24-19(13-5-7-15(8-6-13)23(25)26)21-14-9-20-22(10-14)11-16-12-27-17-3-1-2-4-18(17)28-16/h1-10,16H,11-12H2,(H,21,24) |
| InChIKey | UDSQGHPFTQQWEX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|