C19H15ClN4O5 — CID 90622583
2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]-5-nitrobenzamide (PubChem CID 90622583) has the molecular formula C19H15ClN4O5 and a molecular weight of 414.81 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 90622583 |
| Molecular Formula | C19H15ClN4O5 |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]-5-nitrobenzamide |
| SMILES | O=C(Nc1cnn(CC2COc3ccccc3O2)c1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C19H15ClN4O5/c20-16-6-5-13(24(26)27)7-15(16)19(25)22-12-8-21-23(9-12)10-14-11-28-17-3-1-2-4-18(17)29-14/h1-9,14H,10-11H2,(H,22,25) |
| InChIKey | BIRCIWRWGFHZMY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|