C16H18N4O4 — CID 121145194
4-nitro-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]benzamide (PubChem CID 121145194) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-nitro-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]benzamide.
| Compound Name | 4-nitro-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 121145194 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 4-nitro-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]benzamide |
| SMILES | O=C(Nc1cnn(CC2CCCCO2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H18N4O4/c21-16(12-4-6-14(7-5-12)20(22)23)18-13-9-17-19(10-13)11-15-3-1-2-8-24-15/h4-7,9-10,15H,1-3,8,11H2,(H,18,21) |
| InChIKey | SWOQYUAZPFZEDJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|