C14H22N2O5S — CID 90623418
N-[2-methoxy-2-(3-methoxyphenyl)ethyl]-2-[methyl(methylsulfonyl)amino]acetamide (PubChem CID 90623418) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[2-methoxy-2-(3-methoxyphenyl)ethyl]-2-[methyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-[2-methoxy-2-(3-methoxyphenyl)ethyl]-2-[methyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 90623418 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[2-methoxy-2-(3-methoxyphenyl)ethyl]-2-[methyl(methylsulfonyl)amino]acetamide |
| SMILES | COc1cccc(C(CNC(=O)CN(C)S(C)(=O)=O)OC)c1 |
| InChI | InChI=1S/C14H22N2O5S/c1-16(22(4,18)19)10-14(17)15-9-13(21-3)11-6-5-7-12(8-11)20-2/h5-8,13H,9-10H2,1-4H3,(H,15,17) |
| InChIKey | LAKFSABKBAUTEE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |